CID 3434154
2-ethoxybenzothiazole
Structural Information
- Molecular Formula
- C9H9NOS
- SMILES
- CCOC1=NC2=CC=CC=C2S1
- InChI
- InChI=1S/C9H9NOS/c1-2-11-9-10-7-5-3-4-6-8(7)12-9/h3-6H,2H2,1H3
- InChIKey
- LLQCHJGEDKLPOX-UHFFFAOYSA-N
- Compound name
- 2-ethoxy-1,3-benzothiazole
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 180.04776 | 133.4 |
| [M+Na]+ | 202.02970 | 145.0 |
| [M-H]- | 178.03320 | 137.9 |
| [M+NH4]+ | 197.07430 | 156.3 |
| [M+K]+ | 218.00364 | 142.0 |
| [M+H-H2O]+ | 162.03774 | 127.9 |
| [M+HCOO]- | 224.03868 | 154.2 |
| [M+CH3COO]- | 238.05433 | 148.5 |
| [M+Na-2H]- | 200.01515 | 139.3 |
| [M]+ | 179.03993 | 139.2 |
| [M]- | 179.04103 | 139.2 |