CID 3390511
4-mercaptophenylacetic acid
Structural Information
- Molecular Formula
- C8H8O2S
- SMILES
- C1=CC(=CC=C1CC(=O)O)S
- InChI
- InChI=1S/C8H8O2S/c9-8(10)5-6-1-3-7(11)4-2-6/h1-4,11H,5H2,(H,9,10)
- InChIKey
- ORXSLDYRYTVAPC-UHFFFAOYSA-N
- Compound name
- 2-(4-sulfanylphenyl)acetic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 169.03178 | 131.6 |
| [M+Na]+ | 191.01372 | 140.0 |
| [M-H]- | 167.01722 | 134.6 |
| [M+NH4]+ | 186.05832 | 152.1 |
| [M+K]+ | 206.98766 | 137.3 |
| [M+H-H2O]+ | 151.02176 | 126.5 |
| [M+HCOO]- | 213.02270 | 149.3 |
| [M+CH3COO]- | 227.03835 | 174.6 |
| [M+Na-2H]- | 188.99917 | 134.8 |
| [M]+ | 168.02395 | 133.4 |
| [M]- | 168.02505 | 133.4 |