CID 3161864
3-(3-hydroxy-5-isoxazolyl)propanoic acid
Structural Information
- Molecular Formula
- C6H7NO4
- SMILES
- C1=C(ONC1=O)CCC(=O)O
- InChI
- InChI=1S/C6H7NO4/c8-5-3-4(11-7-5)1-2-6(9)10/h3H,1-2H2,(H,7,8)(H,9,10)
- InChIKey
- KUDOVWCIEXGFGN-UHFFFAOYSA-N
- Compound name
- 3-(3-oxo-1,2-oxazol-5-yl)propanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 158.04478 | 127.8 |
| [M+Na]+ | 180.02672 | 136.6 |
| [M-H]- | 156.03022 | 128.5 |
| [M+NH4]+ | 175.07132 | 146.4 |
| [M+K]+ | 196.00066 | 135.8 |
| [M+H-H2O]+ | 140.03476 | 122.4 |
| [M+HCOO]- | 202.03570 | 149.1 |
| [M+CH3COO]- | 216.05135 | 168.3 |
| [M+Na-2H]- | 178.01217 | 133.3 |
| [M]+ | 157.03695 | 128.7 |
| [M]- | 157.03805 | 128.7 |