CID 3044259
1-piperazineacetic acid, 4-phenyl-, ethyl ester
Structural Information
- Molecular Formula
- C14H20N2O2
- SMILES
- CCOC(=O)CN1CCN(CC1)C2=CC=CC=C2
- InChI
- InChI=1S/C14H20N2O2/c1-2-18-14(17)12-15-8-10-16(11-9-15)13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3
- InChIKey
- OHSLVANDVCNDGK-UHFFFAOYSA-N
- Compound name
- ethyl 2-(4-phenylpiperazin-1-yl)acetate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 249.15976 | 159.1 |
| [M+Na]+ | 271.14170 | 163.4 |
| [M-H]- | 247.14520 | 161.7 |
| [M+NH4]+ | 266.18630 | 173.0 |
| [M+K]+ | 287.11564 | 160.8 |
| [M+H-H2O]+ | 231.14974 | 149.6 |
| [M+HCOO]- | 293.15068 | 176.0 |
| [M+CH3COO]- | 307.16633 | 192.9 |
| [M+Na-2H]- | 269.12715 | 162.2 |
| [M]+ | 248.15193 | 156.6 |
| [M]- | 248.15303 | 156.6 |