CID 3016411
3-ethenylcyclohexan-1-ol
Structural Information
- Molecular Formula
- C8H14O
- SMILES
- C=CC1CCCC(C1)O
- InChI
- InChI=1S/C8H14O/c1-2-7-4-3-5-8(9)6-7/h2,7-9H,1,3-6H2
- InChIKey
- ZYBGGGUBHNFAEV-UHFFFAOYSA-N
- Compound name
- 3-ethenylcyclohexan-1-ol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 127.11174 | 127.1 |
| [M+Na]+ | 149.09368 | 132.6 |
| [M-H]- | 125.09718 | 128.8 |
| [M+NH4]+ | 144.13828 | 148.6 |
| [M+K]+ | 165.06762 | 130.7 |
| [M+H-H2O]+ | 109.10172 | 122.4 |
| [M+HCOO]- | 171.10266 | 146.5 |
| [M+CH3COO]- | 185.11831 | 169.0 |
| [M+Na-2H]- | 147.07913 | 131.7 |
| [M]+ | 126.10391 | 121.5 |
| [M]- | 126.10501 | 121.5 |