CID 29465
19137-94-1
Structural Information
- Molecular Formula
- C14H18N2O
- SMILES
- CN1CCCC1C2=CNC3=C2C=C(C=C3)OC
- InChI
- InChI=1S/C14H18N2O/c1-16-7-3-4-14(16)12-9-15-13-6-5-10(17-2)8-11(12)13/h5-6,8-9,14-15H,3-4,7H2,1-2H3
- InChIKey
- NNCOKSDPKDOAOW-UHFFFAOYSA-N
- Compound name
- 5-methoxy-3-(1-methylpyrrolidin-2-yl)-1H-indole
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 231.14918 | 152.6 |
| [M+Na]+ | 253.13112 | 161.7 |
| [M-H]- | 229.13462 | 156.9 |
| [M+NH4]+ | 248.17572 | 172.2 |
| [M+K]+ | 269.10506 | 157.2 |
| [M+H-H2O]+ | 213.13916 | 145.3 |
| [M+HCOO]- | 275.14010 | 173.1 |
| [M+CH3COO]- | 289.15575 | 165.1 |
| [M+Na-2H]- | 251.11657 | 154.4 |
| [M]+ | 230.14135 | 152.5 |
| [M]- | 230.14245 | 152.5 |