CID 2772787
2-[(1-methyl-1h-1,3-benzodiazol-2-yl)amino]ethan-1-ol
Structural Information
- Molecular Formula
- C10H13N3O
- SMILES
- CN1C2=CC=CC=C2N=C1NCCO
- InChI
- InChI=1S/C10H13N3O/c1-13-9-5-3-2-4-8(9)12-10(13)11-6-7-14/h2-5,14H,6-7H2,1H3,(H,11,12)
- InChIKey
- AGVCWRQUNMNVHV-UHFFFAOYSA-N
- Compound name
- 2-[(1-methylbenzimidazol-2-yl)amino]ethanol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 192.11315 | 139.4 |
| [M+Na]+ | 214.09509 | 149.3 |
| [M-H]- | 190.09859 | 140.7 |
| [M+NH4]+ | 209.13969 | 158.8 |
| [M+K]+ | 230.06903 | 145.6 |
| [M+H-H2O]+ | 174.10313 | 132.3 |
| [M+HCOO]- | 236.10407 | 162.9 |
| [M+CH3COO]- | 250.11972 | 183.4 |
| [M+Na-2H]- | 212.08054 | 147.3 |
| [M]+ | 191.10532 | 141.3 |
| [M]- | 191.10642 | 141.3 |