CID 2764423
Methyl 2-hydroxy-4-(1h-pyrrol-1-yl)benzoate
Structural Information
- Molecular Formula
- C12H11NO3
- SMILES
- COC(=O)C1=C(C=C(C=C1)N2C=CC=C2)O
- InChI
- InChI=1S/C12H11NO3/c1-16-12(15)10-5-4-9(8-11(10)14)13-6-2-3-7-13/h2-8,14H,1H3
- InChIKey
- FOBLNLGBEWRJLG-UHFFFAOYSA-N
- Compound name
- methyl 2-hydroxy-4-pyrrol-1-ylbenzoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 218.08118 | 145.5 |
| [M+Na]+ | 240.06312 | 154.2 |
| [M-H]- | 216.06662 | 150.4 |
| [M+NH4]+ | 235.10772 | 163.9 |
| [M+K]+ | 256.03706 | 151.6 |
| [M+H-H2O]+ | 200.07116 | 138.6 |
| [M+HCOO]- | 262.07210 | 168.5 |
| [M+CH3COO]- | 276.08775 | 183.7 |
| [M+Na-2H]- | 238.04857 | 149.1 |
| [M]+ | 217.07335 | 147.0 |
| [M]- | 217.07445 | 147.0 |