CID 2760339
4-phenoxybenzhydrazide
Structural Information
- Molecular Formula
- C13H12N2O2
- SMILES
- C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)NN
- InChI
- InChI=1S/C13H12N2O2/c14-15-13(16)10-6-8-12(9-7-10)17-11-4-2-1-3-5-11/h1-9H,14H2,(H,15,16)
- InChIKey
- LRBASDKESQRLCX-UHFFFAOYSA-N
- Compound name
- 4-phenoxybenzohydrazide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 229.09715 | 149.0 |
| [M+Na]+ | 251.07909 | 155.2 |
| [M-H]- | 227.08259 | 155.3 |
| [M+NH4]+ | 246.12369 | 165.7 |
| [M+K]+ | 267.05303 | 152.1 |
| [M+H-H2O]+ | 211.08713 | 141.1 |
| [M+HCOO]- | 273.08807 | 174.8 |
| [M+CH3COO]- | 287.10372 | 192.9 |
| [M+Na-2H]- | 249.06454 | 155.4 |
| [M]+ | 228.08932 | 147.1 |
| [M]- | 228.09042 | 147.1 |