CID 2756256
4-(diethylamino)but-2-yn-1-yl acetate
Structural Information
- Molecular Formula
- C10H17NO2
- SMILES
- CCN(CC)CC#CCOC(=O)C
- InChI
- InChI=1S/C10H17NO2/c1-4-11(5-2)8-6-7-9-13-10(3)12/h4-5,8-9H2,1-3H3
- InChIKey
- AQEDWWHCJSXKHP-UHFFFAOYSA-N
- Compound name
- 4-(diethylamino)but-2-ynyl acetate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 184.13321 | 141.1 |
| [M+Na]+ | 206.11515 | 148.8 |
| [M-H]- | 182.11865 | 141.7 |
| [M+NH4]+ | 201.15975 | 159.4 |
| [M+K]+ | 222.08909 | 148.4 |
| [M+H-H2O]+ | 166.12319 | 129.6 |
| [M+HCOO]- | 228.12413 | 159.3 |
| [M+CH3COO]- | 242.13978 | 195.2 |
| [M+Na-2H]- | 204.10060 | 144.0 |
| [M]+ | 183.12538 | 139.4 |
| [M]- | 183.12648 | 139.4 |