CID 2740915
3-(2,4-dichlorophenyl)propanoic acid
Structural Information
- Molecular Formula
- C9H8Cl2O2
- SMILES
- C1=CC(=C(C=C1Cl)Cl)CCC(=O)O
- InChI
- InChI=1S/C9H8Cl2O2/c10-7-3-1-6(8(11)5-7)2-4-9(12)13/h1,3,5H,2,4H2,(H,12,13)
- InChIKey
- HLNPVFSCAMKIOD-UHFFFAOYSA-N
- Compound name
- 3-(2,4-dichlorophenyl)propanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 218.99741 | 139.3 |
| [M+Na]+ | 240.97935 | 149.3 |
| [M-H]- | 216.98285 | 141.5 |
| [M+NH4]+ | 236.02395 | 158.8 |
| [M+K]+ | 256.95329 | 144.0 |
| [M+H-H2O]+ | 200.98739 | 136.1 |
| [M+HCOO]- | 262.98833 | 152.5 |
| [M+CH3COO]- | 277.00398 | 183.6 |
| [M+Na-2H]- | 238.96480 | 143.4 |
| [M]+ | 217.98958 | 142.8 |
| [M]- | 217.99068 | 142.8 |