CID 255273
1-phenylimidazolidin-2-one
Structural Information
- Molecular Formula
- C9H10N2O
- SMILES
- C1CN(C(=O)N1)C2=CC=CC=C2
- InChI
- InChI=1S/C9H10N2O/c12-9-10-6-7-11(9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,12)
- InChIKey
- QKKGTRSHKSWYAK-UHFFFAOYSA-N
- Compound name
- 1-phenylimidazolidin-2-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 163.08660 | 133.4 |
| [M+Na]+ | 185.06854 | 140.8 |
| [M-H]- | 161.07204 | 135.9 |
| [M+NH4]+ | 180.11314 | 152.2 |
| [M+K]+ | 201.04248 | 137.6 |
| [M+H-H2O]+ | 145.07658 | 125.8 |
| [M+HCOO]- | 207.07752 | 153.6 |
| [M+CH3COO]- | 221.09317 | 146.1 |
| [M+Na-2H]- | 183.05399 | 138.3 |
| [M]+ | 162.07877 | 128.9 |
| [M]- | 162.07987 | 128.9 |