CID 250681
3-phenylpiperazin-2-one
Structural Information
- Molecular Formula
- C10H12N2O
- SMILES
- C1CNC(=O)C(N1)C2=CC=CC=C2
- InChI
- InChI=1S/C10H12N2O/c13-10-9(11-6-7-12-10)8-4-2-1-3-5-8/h1-5,9,11H,6-7H2,(H,12,13)
- InChIKey
- WKFFHKBGGZHQAX-UHFFFAOYSA-N
- Compound name
- 3-phenylpiperazin-2-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 177.10224 | 139.0 |
| [M+Na]+ | 199.08418 | 144.6 |
| [M-H]- | 175.08768 | 139.5 |
| [M+NH4]+ | 194.12878 | 154.5 |
| [M+K]+ | 215.05812 | 140.0 |
| [M+H-H2O]+ | 159.09222 | 131.1 |
| [M+HCOO]- | 221.09316 | 155.1 |
| [M+CH3COO]- | 235.10881 | 149.7 |
| [M+Na-2H]- | 197.06963 | 144.5 |
| [M]+ | 176.09441 | 130.7 |
| [M]- | 176.09551 | 130.7 |