CID 249306
18389-46-3
Structural Information
- Molecular Formula
- C7H9NO2S
- SMILES
- C1=CSC(=C1)C(CC(=O)O)N
- InChI
- InChI=1S/C7H9NO2S/c8-5(4-7(9)10)6-2-1-3-11-6/h1-3,5H,4,8H2,(H,9,10)
- InChIKey
- GYAYLYLPTPXESE-UHFFFAOYSA-N
- Compound name
- 3-amino-3-thiophen-2-ylpropanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 172.04268 | 136.2 |
| [M+Na]+ | 194.02462 | 142.9 |
| [M-H]- | 170.02812 | 138.2 |
| [M+NH4]+ | 189.06922 | 157.3 |
| [M+K]+ | 209.99856 | 140.7 |
| [M+H-H2O]+ | 154.03266 | 130.7 |
| [M+HCOO]- | 216.03360 | 154.2 |
| [M+CH3COO]- | 230.04925 | 175.6 |
| [M+Na-2H]- | 192.01007 | 136.3 |
| [M]+ | 171.03485 | 135.6 |
| [M]- | 171.03595 | 135.6 |