CID 246831
1-hexanoylpiperidine
Structural Information
- Molecular Formula
- C11H21NO
- SMILES
- CCCCCC(=O)N1CCCCC1
- InChI
- InChI=1S/C11H21NO/c1-2-3-5-8-11(13)12-9-6-4-7-10-12/h2-10H2,1H3
- InChIKey
- WQQIRPPFBDVVLP-UHFFFAOYSA-N
- Compound name
- 1-piperidin-1-ylhexan-1-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 184.16959 | 145.7 |
| [M+Na]+ | 206.15153 | 149.2 |
| [M-H]- | 182.15503 | 146.4 |
| [M+NH4]+ | 201.19613 | 164.0 |
| [M+K]+ | 222.12547 | 147.9 |
| [M+H-H2O]+ | 166.15957 | 138.8 |
| [M+HCOO]- | 228.16051 | 163.4 |
| [M+CH3COO]- | 242.17616 | 182.5 |
| [M+Na-2H]- | 204.13698 | 148.6 |
| [M]+ | 183.16176 | 142.6 |
| [M]- | 183.16286 | 142.6 |