CID 233815
2',3'-dihydrospiro[imidazolidine-4,1'-indene]-2,5-dione
Structural Information
- Molecular Formula
- C11H10N2O2
- SMILES
- C1CC2(C3=CC=CC=C31)C(=O)NC(=O)N2
- InChI
- InChI=1S/C11H10N2O2/c14-9-11(13-10(15)12-9)6-5-7-3-1-2-4-8(7)11/h1-4H,5-6H2,(H2,12,13,14,15)
- InChIKey
- CDALGRHRPPTQPM-UHFFFAOYSA-N
- Compound name
- spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 203.08151 | 144.1 |
| [M+Na]+ | 225.06345 | 153.4 |
| [M-H]- | 201.06695 | 146.1 |
| [M+NH4]+ | 220.10805 | 166.1 |
| [M+K]+ | 241.03739 | 148.3 |
| [M+H-H2O]+ | 185.07149 | 138.1 |
| [M+HCOO]- | 247.07243 | 161.8 |
| [M+CH3COO]- | 261.08808 | 156.4 |
| [M+Na-2H]- | 223.04890 | 147.6 |
| [M]+ | 202.07368 | 139.1 |
| [M]- | 202.07478 | 139.1 |