CID 22859864
2-(hydroxyamino)-3-methylbutanoic acid
Structural Information
- Molecular Formula
- C5H11NO3
- SMILES
- CC(C)[C@@H](C(=O)O)NO
- InChI
- InChI=1S/C5H11NO3/c1-3(2)4(6-9)5(7)8/h3-4,6,9H,1-2H3,(H,7,8)/t4-/m0/s1
- InChIKey
- PXEKBQAJOBYINU-BYPYZUCNSA-N
- Compound name
- (2S)-2-(hydroxyamino)-3-methylbutanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 134.08118 | 128.3 |
| [M+Na]+ | 156.06312 | 133.8 |
| [M-H]- | 132.06662 | 126.0 |
| [M+NH4]+ | 151.10772 | 148.3 |
| [M+K]+ | 172.03706 | 134.1 |
| [M+H-H2O]+ | 116.07116 | 123.8 |
| [M+HCOO]- | 178.07210 | 148.3 |
| [M+CH3COO]- | 192.08775 | 171.5 |
| [M+Na-2H]- | 154.04857 | 131.1 |
| [M]+ | 133.07335 | 126.2 |
| [M]- | 133.07445 | 126.2 |