CID 20974
2,4-dinitrobenzyl alcohol
Structural Information
- Molecular Formula
- C7H6N2O5
- SMILES
- C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CO
- InChI
- InChI=1S/C7H6N2O5/c10-4-5-1-2-6(8(11)12)3-7(5)9(13)14/h1-3,10H,4H2
- InChIKey
- ZKKOBDGQUYKWFN-UHFFFAOYSA-N
- Compound name
- (2,4-dinitrophenyl)methanol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 199.03494 | 138.0 |
| [M+Na]+ | 221.01688 | 144.7 |
| [M-H]- | 197.02038 | 140.9 |
| [M+NH4]+ | 216.06148 | 154.5 |
| [M+K]+ | 236.99082 | 135.3 |
| [M+H-H2O]+ | 181.02492 | 141.3 |
| [M+HCOO]- | 243.02586 | 163.3 |
| [M+CH3COO]- | 257.04151 | 170.8 |
| [M+Na-2H]- | 219.00233 | 147.1 |
| [M]+ | 198.02711 | 134.9 |
| [M]- | 198.02821 | 134.9 |