CID 209069
5-methylthiophene-3-carboxylic acid
Structural Information
- Molecular Formula
- C6H6O2S
- SMILES
- CC1=CC(=CS1)C(=O)O
- InChI
- InChI=1S/C6H6O2S/c1-4-2-5(3-9-4)6(7)8/h2-3H,1H3,(H,7,8)
- InChIKey
- VFORWJLUXKGLAH-UHFFFAOYSA-N
- Compound name
- 5-methylthiophene-3-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 143.01613 | 126.3 |
| [M+Na]+ | 164.99807 | 135.7 |
| [M-H]- | 141.00157 | 129.6 |
| [M+NH4]+ | 160.04267 | 149.7 |
| [M+K]+ | 180.97201 | 133.8 |
| [M+H-H2O]+ | 125.00611 | 121.9 |
| [M+HCOO]- | 187.00705 | 145.3 |
| [M+CH3COO]- | 201.02270 | 168.7 |
| [M+Na-2H]- | 162.98352 | 128.0 |
| [M]+ | 142.00830 | 128.2 |
| [M]- | 142.00940 | 128.2 |