CID 20277625
7-ethyl-n-methylindole
Structural Information
- Molecular Formula
- C11H13N
- SMILES
- CCC1=CC=CC2=C1N(C=C2)C
- InChI
- InChI=1S/C11H13N/c1-3-9-5-4-6-10-7-8-12(2)11(9)10/h4-8H,3H2,1-2H3
- InChIKey
- PNBISRBPZVZDNJ-UHFFFAOYSA-N
- Compound name
- 7-ethyl-1-methylindole
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 160.11208 | 131.9 |
| [M+Na]+ | 182.09402 | 142.9 |
| [M-H]- | 158.09752 | 136.0 |
| [M+NH4]+ | 177.13862 | 155.1 |
| [M+K]+ | 198.06796 | 139.6 |
| [M+H-H2O]+ | 142.10206 | 126.0 |
| [M+HCOO]- | 204.10300 | 156.7 |
| [M+CH3COO]- | 218.11865 | 147.0 |
| [M+Na-2H]- | 180.07947 | 139.3 |
| [M]+ | 159.10425 | 134.8 |
| [M]- | 159.10535 | 134.8 |