CID 19582717
N-cyclopropyl-5-(thiophen-2-yl)-1,2-oxazole-3-carboxamide
Structural Information
- Molecular Formula
- C11H10N2O2S
- SMILES
- C1CC1NC(=O)C2=NOC(=C2)C3=CC=CS3
- InChI
- InChI=1S/C11H10N2O2S/c14-11(12-7-3-4-7)8-6-9(15-13-8)10-2-1-5-16-10/h1-2,5-7H,3-4H2,(H,12,14)
- InChIKey
- SYENTKHGMVKGAQ-UHFFFAOYSA-N
- Compound name
- N-cyclopropyl-5-thiophen-2-yl-1,2-oxazole-3-carboxamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 235.05358 | 143.5 |
| [M+Na]+ | 257.03552 | 154.8 |
| [M-H]- | 233.03902 | 154.6 |
| [M+NH4]+ | 252.08012 | 157.9 |
| [M+K]+ | 273.00946 | 152.0 |
| [M+H-H2O]+ | 217.04356 | 137.3 |
| [M+HCOO]- | 279.04450 | 165.8 |
| [M+CH3COO]- | 293.06015 | 157.6 |
| [M+Na-2H]- | 255.02097 | 146.2 |
| [M]+ | 234.04575 | 150.2 |
| [M]- | 234.04685 | 150.2 |