CID 18006547
(2-amino-6-hydroxyphenyl)urea
Structural Information
- Molecular Formula
- C7H9N3O2
- SMILES
- C1=CC(=C(C(=C1)O)NC(=O)N)N
- InChI
- InChI=1S/C7H9N3O2/c8-4-2-1-3-5(11)6(4)10-7(9)12/h1-3,11H,8H2,(H3,9,10,12)
- InChIKey
- RMFGWLPGWZGXON-UHFFFAOYSA-N
- Compound name
- (2-amino-6-hydroxyphenyl)urea
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 168.07675 | 132.9 |
| [M+Na]+ | 190.05869 | 140.0 |
| [M-H]- | 166.06219 | 135.0 |
| [M+NH4]+ | 185.10329 | 151.5 |
| [M+K]+ | 206.03263 | 137.9 |
| [M+H-H2O]+ | 150.06673 | 126.8 |
| [M+HCOO]- | 212.06767 | 158.0 |
| [M+CH3COO]- | 226.08332 | 182.6 |
| [M+Na-2H]- | 188.04414 | 137.6 |
| [M]+ | 167.06892 | 128.1 |
| [M]- | 167.07002 | 128.1 |