CID 17191
Disperse blue 3
Structural Information
- Molecular Formula
- C17H16N2O3
- SMILES
- CNC1=C2C(=C(C=C1)NCCO)C(=O)C3=CC=CC=C3C2=O
- InChI
- InChI=1S/C17H16N2O3/c1-18-12-6-7-13(19-8-9-20)15-14(12)16(21)10-4-2-3-5-11(10)17(15)22/h2-7,18-20H,8-9H2,1H3
- InChIKey
- NLXFWUZKOOWWFD-UHFFFAOYSA-N
- Compound name
- 1-(2-hydroxyethylamino)-4-(methylamino)anthracene-9,10-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 297.12338 | 164.2 |
| [M+Na]+ | 319.10532 | 172.5 |
| [M-H]- | 295.10882 | 168.6 |
| [M+NH4]+ | 314.14992 | 180.7 |
| [M+K]+ | 335.07926 | 167.5 |
| [M+H-H2O]+ | 279.11336 | 157.0 |
| [M+HCOO]- | 341.11430 | 185.6 |
| [M+CH3COO]- | 355.12995 | 209.4 |
| [M+Na-2H]- | 317.09077 | 170.7 |
| [M]+ | 296.11555 | 164.7 |
| [M]- | 296.11665 | 164.7 |