CID 170420
2-propyl-1-aminopentane
Structural Information
- Molecular Formula
- C8H19N
- SMILES
- CCCC(CCC)CN
- InChI
- InChI=1S/C8H19N/c1-3-5-8(7-9)6-4-2/h8H,3-7,9H2,1-2H3
- InChIKey
- MZYRSJXJDRNBAE-UHFFFAOYSA-N
- Compound name
- 2-propylpentan-1-amine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 130.15903 | 133.3 |
| [M+Na]+ | 152.14097 | 138.6 |
| [M-H]- | 128.14447 | 132.7 |
| [M+NH4]+ | 147.18557 | 155.1 |
| [M+K]+ | 168.11491 | 138.0 |
| [M+H-H2O]+ | 112.14901 | 128.3 |
| [M+HCOO]- | 174.14995 | 155.8 |
| [M+CH3COO]- | 188.16560 | 178.2 |
| [M+Na-2H]- | 150.12642 | 137.2 |
| [M]+ | 129.15120 | 132.8 |
| [M]- | 129.15230 | 132.8 |