CID 159278
Salidroside
Structural Information
- Molecular Formula
- C14H20O7
- SMILES
- C1=CC(=CC=C1CCO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O
- InChI
- InChI=1S/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2/t10-,11-,12+,13-,14-/m1/s1
- InChIKey
- ILRCGYURZSFMEG-RKQHYHRCSA-N
- Compound name
- (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxane-3,4,5-triol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 301.12818 | 166.7 |
| [M+Na]+ | 323.11012 | 171.8 |
| [M-H]- | 299.11362 | 167.4 |
| [M+NH4]+ | 318.15472 | 177.2 |
| [M+K]+ | 339.08406 | 169.8 |
| [M+H-H2O]+ | 283.11816 | 160.0 |
| [M+HCOO]- | 345.11910 | 179.5 |
| [M+CH3COO]- | 359.13475 | 193.0 |
| [M+Na-2H]- | 321.09557 | 167.3 |
| [M]+ | 300.12035 | 165.3 |
| [M]- | 300.12145 | 165.3 |