CID 158525
2-(4-ethoxyphenyl)-2-methylpropanol
Structural Information
- Molecular Formula
- C12H18O2
- SMILES
- CCOC1=CC=C(C=C1)C(C)(C)CO
- InChI
- InChI=1S/C12H18O2/c1-4-14-11-7-5-10(6-8-11)12(2,3)9-13/h5-8,13H,4,9H2,1-3H3
- InChIKey
- OZEZBKUHAGFQME-UHFFFAOYSA-N
- Compound name
- 2-(4-ethoxyphenyl)-2-methylpropan-1-ol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 195.13796 | 144.4 |
| [M+Na]+ | 217.11990 | 151.5 |
| [M-H]- | 193.12340 | 146.7 |
| [M+NH4]+ | 212.16450 | 163.6 |
| [M+K]+ | 233.09384 | 149.4 |
| [M+H-H2O]+ | 177.12794 | 139.1 |
| [M+HCOO]- | 239.12888 | 165.4 |
| [M+CH3COO]- | 253.14453 | 183.3 |
| [M+Na-2H]- | 215.10535 | 150.5 |
| [M]+ | 194.13013 | 146.3 |
| [M]- | 194.13123 | 146.4 |