CID 152807
4-hydroxy-2-pyrrolidone
Structural Information
- Molecular Formula
- C4H7NO2
- SMILES
- C1C(CNC1=O)O
- InChI
- InChI=1S/C4H7NO2/c6-3-1-4(7)5-2-3/h3,6H,1-2H2,(H,5,7)
- InChIKey
- IOGISYQVOGVIEU-UHFFFAOYSA-N
- Compound name
- 4-hydroxypyrrolidin-2-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 102.05495 | 117.9 |
| [M+Na]+ | 124.03689 | 125.6 |
| [M-H]- | 100.04040 | 117.5 |
| [M+NH4]+ | 119.08150 | 140.1 |
| [M+K]+ | 140.01083 | 124.1 |
| [M+H-H2O]+ | 84.044936 | 113.0 |
| [M+HCOO]- | 146.04588 | 138.2 |
| [M+CH3COO]- | 160.06153 | 158.6 |
| [M+Na-2H]- | 122.02234 | 122.7 |
| [M]+ | 101.04713 | 113.0 |
| [M]- | 101.04822 | 113.0 |