CID 15216
4,4'-dinitrobiphenyl
Structural Information
- Molecular Formula
- C12H8N2O4
- SMILES
- C1=CC(=CC=C1C2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-]
- InChI
- InChI=1S/C12H8N2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8H
- InChIKey
- BDLNCFCZHNKBGI-UHFFFAOYSA-N
- Compound name
- 1-nitro-4-(4-nitrophenyl)benzene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 245.05568 | 152.7 |
| [M+Na]+ | 267.03762 | 158.4 |
| [M-H]- | 243.04112 | 159.4 |
| [M+NH4]+ | 262.08222 | 167.3 |
| [M+K]+ | 283.01156 | 147.7 |
| [M+H-H2O]+ | 227.04566 | 153.9 |
| [M+HCOO]- | 289.04660 | 178.7 |
| [M+CH3COO]- | 303.06225 | 182.6 |
| [M+Na-2H]- | 265.02307 | 161.7 |
| [M]+ | 244.04785 | 149.2 |
| [M]- | 244.04895 | 149.2 |