CID 14902203
Butanedioic acid, 2,3-dibutyl-
Structural Information
- Molecular Formula
- C12H22O4
- SMILES
- CCCCC(C(CCCC)C(=O)O)C(=O)O
- InChI
- InChI=1S/C12H22O4/c1-3-5-7-9(11(13)14)10(12(15)16)8-6-4-2/h9-10H,3-8H2,1-2H3,(H,13,14)(H,15,16)
- InChIKey
- BQNDPALRJDCXOY-UHFFFAOYSA-N
- Compound name
- 2,3-dibutylbutanedioic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 231.15909 | 157.4 |
| [M+Na]+ | 253.14103 | 160.9 |
| [M-H]- | 229.14453 | 154.0 |
| [M+NH4]+ | 248.18563 | 173.7 |
| [M+K]+ | 269.11497 | 159.9 |
| [M+H-H2O]+ | 213.14907 | 152.1 |
| [M+HCOO]- | 275.15001 | 173.6 |
| [M+CH3COO]- | 289.16566 | 189.7 |
| [M+Na-2H]- | 251.12648 | 155.2 |
| [M]+ | 230.15126 | 158.9 |
| [M]- | 230.15236 | 158.9 |