CID 14556305
1689-86-7
Structural Information
- Molecular Formula
- C7H3BrClNO
- SMILES
- C1=C(C=C(C(=C1Cl)O)Br)C#N
- InChI
- InChI=1S/C7H3BrClNO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H
- InChIKey
- HUMVTCUIXLNMDF-UHFFFAOYSA-N
- Compound name
- 3-bromo-5-chloro-4-hydroxybenzonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 231.91593 | 133.7 |
| [M+Na]+ | 253.89787 | 150.1 |
| [M-H]- | 229.90137 | 138.1 |
| [M+NH4]+ | 248.94247 | 154.0 |
| [M+K]+ | 269.87181 | 136.6 |
| [M+H-H2O]+ | 213.90591 | 128.8 |
| [M+HCOO]- | 275.90685 | 150.1 |
| [M+CH3COO]- | 289.92250 | 195.3 |
| [M+Na-2H]- | 251.88332 | 140.7 |
| [M]+ | 230.90810 | 147.1 |
| [M]- | 230.90920 | 147.1 |