CID 14353376
5-hydroxy-7,8-dimethoxy-2-(4-methoxyphenyl)-4h-1-benzopyran-4-one
Structural Information
- Molecular Formula
- C18H16O6
- SMILES
- COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)OC)OC
- InChI
- InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)14-8-12(19)16-13(20)9-15(22-2)17(23-3)18(16)24-14/h4-9,20H,1-3H3
- InChIKey
- RRZRJBICWWNHRB-UHFFFAOYSA-N
- Compound name
- 5-hydroxy-7,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 329.10198 | 172.1 |
| [M+Na]+ | 351.08392 | 183.0 |
| [M-H]- | 327.08742 | 180.6 |
| [M+NH4]+ | 346.12852 | 185.7 |
| [M+K]+ | 367.05786 | 181.5 |
| [M+H-H2O]+ | 311.09196 | 163.8 |
| [M+HCOO]- | 373.09290 | 193.6 |
| [M+CH3COO]- | 387.10855 | 208.8 |
| [M+Na-2H]- | 349.06937 | 177.4 |
| [M]+ | 328.09415 | 180.4 |
| [M]- | 328.09525 | 180.4 |