CID 140730
4-butylbenzonitrile
Structural Information
- Molecular Formula
- C11H13N
- SMILES
- CCCCC1=CC=C(C=C1)C#N
- InChI
- InChI=1S/C11H13N/c1-2-3-4-10-5-7-11(9-12)8-6-10/h5-8H,2-4H2,1H3
- InChIKey
- KGZNJCXNPLUEQS-UHFFFAOYSA-N
- Compound name
- 4-butylbenzonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 160.11208 | 134.7 |
| [M+Na]+ | 182.09402 | 144.6 |
| [M-H]- | 158.09752 | 138.1 |
| [M+NH4]+ | 177.13862 | 153.9 |
| [M+K]+ | 198.06796 | 141.0 |
| [M+H-H2O]+ | 142.10206 | 122.8 |
| [M+HCOO]- | 204.10300 | 155.2 |
| [M+CH3COO]- | 218.11865 | 192.2 |
| [M+Na-2H]- | 180.07947 | 141.0 |
| [M]+ | 159.10425 | 130.7 |
| [M]- | 159.10535 | 130.7 |