CID 13940823
Schembl28898462
Structural Information
- Molecular Formula
- C21H20O10
- SMILES
- CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC=C(C=C4)O)O)O)O)O
- InChI
- InChI=1S/C21H20O10/c1-8-15(24)17(26)19(28)21(29-8)30-11-6-12(23)14-13(7-11)31-20(18(27)16(14)25)9-2-4-10(22)5-3-9/h2-8,15,17,19,21-24,26-28H,1H3
- InChIKey
- HQNOUCSPWAGQND-UHFFFAOYSA-N
- Compound name
- 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 433.11293 | 199.1 |
| [M+Na]+ | 455.09487 | 206.6 |
| [M-H]- | 431.09837 | 204.8 |
| [M+NH4]+ | 450.13947 | 203.1 |
| [M+K]+ | 471.06881 | 206.2 |
| [M+H-H2O]+ | 415.10291 | 189.9 |
| [M+HCOO]- | 477.10385 | 208.0 |
| [M+CH3COO]- | 491.11950 | 222.4 |
| [M+Na-2H]- | 453.08032 | 198.7 |
| [M]+ | 432.10510 | 201.2 |
| [M]- | 432.10620 | 201.2 |