CID 13695
9-aminophenanthrene
Structural Information
- Molecular Formula
- C14H11N
- SMILES
- C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)N
- InChI
- InChI=1S/C14H11N/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H,15H2
- InChIKey
- KIHQWOBUUIPWAN-UHFFFAOYSA-N
- Compound name
- phenanthren-9-amine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 194.09642 | 137.9 |
| [M+Na]+ | 216.07836 | 148.3 |
| [M-H]- | 192.08186 | 143.7 |
| [M+NH4]+ | 211.12296 | 159.4 |
| [M+K]+ | 232.05230 | 142.9 |
| [M+H-H2O]+ | 176.08640 | 131.5 |
| [M+HCOO]- | 238.08734 | 162.4 |
| [M+CH3COO]- | 252.10299 | 152.1 |
| [M+Na-2H]- | 214.06381 | 149.0 |
| [M]+ | 193.08859 | 137.7 |
| [M]- | 193.08969 | 137.7 |