CID 13596074
3-(4-aminophenyl)propanamide
Structural Information
- Molecular Formula
- C9H12N2O
- SMILES
- C1=CC(=CC=C1CCC(=O)N)N
- InChI
- InChI=1S/C9H12N2O/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6,10H2,(H2,11,12)
- InChIKey
- WICPORLNXBPBPR-UHFFFAOYSA-N
- Compound name
- 3-(4-aminophenyl)propanamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 165.10224 | 135.1 |
| [M+Na]+ | 187.08418 | 141.7 |
| [M-H]- | 163.08768 | 137.9 |
| [M+NH4]+ | 182.12878 | 154.6 |
| [M+K]+ | 203.05812 | 139.4 |
| [M+H-H2O]+ | 147.09222 | 128.9 |
| [M+HCOO]- | 209.09316 | 159.8 |
| [M+CH3COO]- | 223.10881 | 182.9 |
| [M+Na-2H]- | 185.06963 | 139.7 |
| [M]+ | 164.09441 | 131.9 |
| [M]- | 164.09551 | 131.9 |