CID 13576
3-decanone
Structural Information
- Molecular Formula
- C10H20O
- SMILES
- CCCCCCCC(=O)CC
- InChI
- InChI=1S/C10H20O/c1-3-5-6-7-8-9-10(11)4-2/h3-9H2,1-2H3
- InChIKey
- XJLDYKIEURAVBW-UHFFFAOYSA-N
- Compound name
- decan-3-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 157.15869 | 139.1 |
| [M+Na]+ | 179.14063 | 144.8 |
| [M-H]- | 155.14413 | 138.8 |
| [M+NH4]+ | 174.18523 | 160.3 |
| [M+K]+ | 195.11457 | 143.9 |
| [M+H-H2O]+ | 139.14867 | 134.2 |
| [M+HCOO]- | 201.14961 | 161.0 |
| [M+CH3COO]- | 215.16526 | 181.3 |
| [M+Na-2H]- | 177.12608 | 142.9 |
| [M]+ | 156.15086 | 142.0 |
| [M]- | 156.15196 | 142.0 |