CID 13528343
1-(2-amino-5-chlorophenyl)ethanone
Structural Information
- Molecular Formula
- C8H8ClNO
- SMILES
- CC(=O)C1=C(C=CC(=C1)Cl)N
- InChI
- InChI=1S/C8H8ClNO/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,10H2,1H3
- InChIKey
- AQBCDAORSNHFNR-UHFFFAOYSA-N
- Compound name
- 1-(2-amino-5-chlorophenyl)ethanone
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 170.03671 | 131.8 |
| [M+Na]+ | 192.01865 | 141.5 |
| [M-H]- | 168.02215 | 135.6 |
| [M+NH4]+ | 187.06325 | 153.0 |
| [M+K]+ | 207.99259 | 137.8 |
| [M+H-H2O]+ | 152.02669 | 127.5 |
| [M+HCOO]- | 214.02763 | 152.0 |
| [M+CH3COO]- | 228.04328 | 180.5 |
| [M+Na-2H]- | 190.00410 | 136.6 |
| [M]+ | 169.02888 | 132.4 |
| [M]- | 169.02998 | 132.4 |