CID 134940
Hexanediamine
Structural Information
- Molecular Formula
- C6H16N2
- SMILES
- CCCCCC(N)N
- InChI
- InChI=1S/C6H16N2/c1-2-3-4-5-6(7)8/h6H,2-5,7-8H2,1H3
- InChIKey
- SYECJBOWSGTPLU-UHFFFAOYSA-N
- Compound name
- hexane-1,1-diamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 117.13863 | 128.3 |
| [M+Na]+ | 139.12057 | 133.5 |
| [M-H]- | 115.12407 | 127.4 |
| [M+NH4]+ | 134.16517 | 149.8 |
| [M+K]+ | 155.09451 | 133.0 |
| [M+H-H2O]+ | 99.128610 | 123.1 |
| [M+HCOO]- | 161.12955 | 151.8 |
| [M+CH3COO]- | 175.14520 | 176.3 |
| [M+Na-2H]- | 137.10602 | 132.2 |
| [M]+ | 116.13080 | 125.1 |
| [M]- | 116.13190 | 125.1 |