CID 132525
111843-78-8
Structural Information
- Molecular Formula
- C21H10Cl2O7
- SMILES
- C1=CC2=C(C=C1C(=O)O)C(=O)OC23C4=CC(=C(C=C4OC5=CC(=C(C=C35)Cl)O)O)Cl
- InChI
- InChI=1S/C21H10Cl2O7/c22-13-4-11-17(6-15(13)24)29-18-7-16(25)14(23)5-12(18)21(11)10-2-1-8(19(26)27)3-9(10)20(28)30-21/h1-7,24-25H,(H,26,27)
- InChIKey
- JGZVUTYDEVUNMK-UHFFFAOYSA-N
- Compound name
- 2',7'-dichloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 444.98763 | 192.6 |
| [M+Na]+ | 466.96957 | 205.9 |
| [M-H]- | 442.97307 | 199.9 |
| [M+NH4]+ | 462.01417 | 206.5 |
| [M+K]+ | 482.94351 | 201.9 |
| [M+H-H2O]+ | 426.97761 | 188.3 |
| [M+HCOO]- | 488.97855 | 196.2 |
| [M+CH3COO]- | 502.99420 | 203.1 |
| [M+Na-2H]- | 464.95502 | 196.1 |
| [M]+ | 443.97980 | 201.0 |
| [M]- | 443.98090 | 201.0 |