CID 13230126
2-bromo-1-methyl-1h-indole
Structural Information
- Molecular Formula
- C9H8BrN
- SMILES
- CN1C2=CC=CC=C2C=C1Br
- InChI
- InChI=1S/C9H8BrN/c1-11-8-5-3-2-4-7(8)6-9(11)10/h2-6H,1H3
- InChIKey
- LWZBTVYFUVWJLB-UHFFFAOYSA-N
- Compound name
- 2-bromo-1-methylindole
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 209.99129 | 135.7 |
| [M+Na]+ | 231.97323 | 150.6 |
| [M-H]- | 207.97673 | 142.7 |
| [M+NH4]+ | 227.01783 | 160.4 |
| [M+K]+ | 247.94717 | 139.5 |
| [M+H-H2O]+ | 191.98127 | 136.4 |
| [M+HCOO]- | 253.98221 | 158.7 |
| [M+CH3COO]- | 267.99786 | 152.7 |
| [M+Na-2H]- | 229.95868 | 145.0 |
| [M]+ | 208.98346 | 156.5 |
| [M]- | 208.98456 | 156.5 |