CID 13227190
2,4-diaminobenzonitrile
Structural Information
- Molecular Formula
- C7H7N3
- SMILES
- C1=CC(=C(C=C1N)N)C#N
- InChI
- InChI=1S/C7H7N3/c8-4-5-1-2-6(9)3-7(5)10/h1-3H,9-10H2
- InChIKey
- BOWQSEMOMSWTKX-UHFFFAOYSA-N
- Compound name
- 2,4-diaminobenzonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 134.07128 | 130.1 |
| [M+Na]+ | 156.05322 | 140.2 |
| [M-H]- | 132.05672 | 133.0 |
| [M+NH4]+ | 151.09782 | 149.0 |
| [M+K]+ | 172.02716 | 137.5 |
| [M+H-H2O]+ | 116.06126 | 118.1 |
| [M+HCOO]- | 178.06220 | 152.0 |
| [M+CH3COO]- | 192.07785 | 189.9 |
| [M+Na-2H]- | 154.03867 | 135.5 |
| [M]+ | 133.06345 | 121.7 |
| [M]- | 133.06455 | 121.7 |