CID 12678707
2-ethylthiophene-3-carboxylic acid
Structural Information
- Molecular Formula
- C7H8O2S
- SMILES
- CCC1=C(C=CS1)C(=O)O
- InChI
- InChI=1S/C7H8O2S/c1-2-6-5(7(8)9)3-4-10-6/h3-4H,2H2,1H3,(H,8,9)
- InChIKey
- LMXGLAZELVIQOB-UHFFFAOYSA-N
- Compound name
- 2-ethylthiophene-3-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 157.03178 | 130.8 |
| [M+Na]+ | 179.01372 | 139.8 |
| [M-H]- | 155.01722 | 134.0 |
| [M+NH4]+ | 174.05832 | 153.7 |
| [M+K]+ | 194.98766 | 137.7 |
| [M+H-H2O]+ | 139.02176 | 126.3 |
| [M+HCOO]- | 201.02270 | 149.6 |
| [M+CH3COO]- | 215.03835 | 171.7 |
| [M+Na-2H]- | 176.99917 | 132.0 |
| [M]+ | 156.02395 | 133.1 |
| [M]- | 156.02505 | 133.1 |