CID 123982
Kelatorphan
Structural Information
- Molecular Formula
- C14H18N2O5
- SMILES
- C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)CC(=O)NO
- InChI
- InChI=1S/C14H18N2O5/c1-9(14(19)20)15-13(18)11(8-12(17)16-21)7-10-5-3-2-4-6-10/h2-6,9,11,21H,7-8H2,1H3,(H,15,18)(H,16,17)(H,19,20)/t9-,11+/m0/s1
- InChIKey
- OJCFZTVYDSKXNM-GXSJLCMTSA-N
- Compound name
- (2S)-2-[[(2R)-2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]amino]propanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 295.12886 | 168.0 |
| [M+Na]+ | 317.11080 | 169.8 |
| [M-H]- | 293.11430 | 168.0 |
| [M+NH4]+ | 312.15540 | 180.3 |
| [M+K]+ | 333.08474 | 168.9 |
| [M+H-H2O]+ | 277.11884 | 160.6 |
| [M+HCOO]- | 339.11978 | 186.6 |
| [M+CH3COO]- | 353.13543 | 202.9 |
| [M+Na-2H]- | 315.09625 | 167.2 |
| [M]+ | 294.12103 | 166.1 |
| [M]- | 294.12213 | 166.1 |