CID 123584
Methyl 3-amino-4-methylthiophene-2-carboxylate
Structural Information
- Molecular Formula
- C7H9NO2S
- SMILES
- CC1=CSC(=C1N)C(=O)OC
- InChI
- InChI=1S/C7H9NO2S/c1-4-3-11-6(5(4)8)7(9)10-2/h3H,8H2,1-2H3
- InChIKey
- YICRPERKKBDRSP-UHFFFAOYSA-N
- Compound name
- methyl 3-amino-4-methylthiophene-2-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 172.04268 | 134.3 |
| [M+Na]+ | 194.02462 | 143.6 |
| [M-H]- | 170.02812 | 138.5 |
| [M+NH4]+ | 189.06922 | 157.0 |
| [M+K]+ | 209.99856 | 141.9 |
| [M+H-H2O]+ | 154.03266 | 129.2 |
| [M+HCOO]- | 216.03360 | 154.8 |
| [M+CH3COO]- | 230.04925 | 178.9 |
| [M+Na-2H]- | 192.01007 | 134.8 |
| [M]+ | 171.03485 | 136.9 |
| [M]- | 171.03595 | 136.9 |