CID 11789614
55745-68-1
Structural Information
- Molecular Formula
- C9H9ClO
- SMILES
- C1COC2=C1C=C(C=C2)CCl
- InChI
- InChI=1S/C9H9ClO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-2,5H,3-4,6H2
- InChIKey
- SWPANFDAIKLKBD-UHFFFAOYSA-N
- Compound name
- 5-(chloromethyl)-2,3-dihydro-1-benzofuran
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 169.04148 | 132.2 |
| [M+Na]+ | 191.02342 | 141.8 |
| [M-H]- | 167.02692 | 137.3 |
| [M+NH4]+ | 186.06802 | 155.3 |
| [M+K]+ | 206.99736 | 139.0 |
| [M+H-H2O]+ | 151.03146 | 128.0 |
| [M+HCOO]- | 213.03240 | 150.6 |
| [M+CH3COO]- | 227.04805 | 146.9 |
| [M+Na-2H]- | 189.00887 | 139.7 |
| [M]+ | 168.03365 | 134.5 |
| [M]- | 168.03475 | 134.5 |