CID 10877146
Methyl 2-aminopent-4-enoate hydrochloride
Structural Information
- Molecular Formula
- C6H11NO2
- SMILES
- COC(=O)C(CC=C)N
- InChI
- InChI=1S/C6H11NO2/c1-3-4-5(7)6(8)9-2/h3,5H,1,4,7H2,2H3
- InChIKey
- JHQZRHILTYGZQL-UHFFFAOYSA-N
- Compound name
- methyl 2-aminopent-4-enoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 130.08626 | 127.6 |
| [M+Na]+ | 152.06820 | 134.2 |
| [M-H]- | 128.07170 | 127.5 |
| [M+NH4]+ | 147.11280 | 149.1 |
| [M+K]+ | 168.04214 | 134.1 |
| [M+H-H2O]+ | 112.07624 | 122.8 |
| [M+HCOO]- | 174.07718 | 150.7 |
| [M+CH3COO]- | 188.09283 | 174.4 |
| [M+Na-2H]- | 150.05365 | 131.2 |
| [M]+ | 129.07843 | 127.1 |
| [M]- | 129.07953 | 127.1 |