CID 10800
2-methyl-4,6-dinitrophenol
Structural Information
- Molecular Formula
- C7H6N2O5
- SMILES
- CC1=CC(=CC(=C1O)[N+](=O)[O-])[N+](=O)[O-]
- InChI
- InChI=1S/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3
- InChIKey
- ZXVONLUNISGICL-UHFFFAOYSA-N
- Compound name
- 2-methyl-4,6-dinitrophenol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 199.03494 | 137.4 |
| [M+Na]+ | 221.01688 | 145.0 |
| [M-H]- | 197.02038 | 140.6 |
| [M+NH4]+ | 216.06148 | 154.1 |
| [M+K]+ | 236.99082 | 135.6 |
| [M+H-H2O]+ | 181.02492 | 140.9 |
| [M+HCOO]- | 243.02586 | 162.7 |
| [M+CH3COO]- | 257.04151 | 171.9 |
| [M+Na-2H]- | 219.00233 | 146.0 |
| [M]+ | 198.02711 | 134.7 |
| [M]- | 198.02821 | 134.7 |