CID 10337420
Dca-s
Structural Information
- Molecular Formula
- C19H18O6
- SMILES
- COC1=CC(=CC(=C1O)/C=C/C2=CC(=C(C=C2)O)OC)/C=C/C(=O)O
- InChI
- InChI=1S/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+
- InChIKey
- SLIMCXCSQXYCGL-JENUQAQBSA-N
- Compound name
- (E)-3-[4-hydroxy-3-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-5-methoxyphenyl]prop-2-enoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 343.11763 | 177.7 |
| [M+Na]+ | 365.09957 | 185.3 |
| [M-H]- | 341.10307 | 181.0 |
| [M+NH4]+ | 360.14417 | 189.3 |
| [M+K]+ | 381.07351 | 180.6 |
| [M+H-H2O]+ | 325.10761 | 170.2 |
| [M+HCOO]- | 387.10855 | 196.5 |
| [M+CH3COO]- | 401.12420 | 205.9 |
| [M+Na-2H]- | 363.08502 | 177.2 |
| [M]+ | 342.10980 | 180.7 |
| [M]- | 342.11090 | 180.7 |