CID 10043694
14348-21-1
Structural Information
- Molecular Formula
- C21H22O5
- SMILES
- CC(=CCOC1=C2C=COC2=C(C3=C1C=CC(=O)O3)OCC=C(C)C)C
- InChI
- InChI=1S/C21H22O5/c1-13(2)7-10-23-18-15-5-6-17(22)26-20(15)21(25-11-8-14(3)4)19-16(18)9-12-24-19/h5-9,12H,10-11H2,1-4H3
- InChIKey
- HJMDOAWWVCOEDW-UHFFFAOYSA-N
- Compound name
- 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 355.15401 | 184.9 |
| [M+Na]+ | 377.13595 | 194.5 |
| [M-H]- | 353.13945 | 192.2 |
| [M+NH4]+ | 372.18055 | 199.6 |
| [M+K]+ | 393.10989 | 192.5 |
| [M+H-H2O]+ | 337.14399 | 178.4 |
| [M+HCOO]- | 399.14493 | 204.7 |
| [M+CH3COO]- | 413.16058 | 215.7 |
| [M+Na-2H]- | 375.12140 | 187.5 |
| [M]+ | 354.14618 | 195.0 |
| [M]- | 354.14728 | 195.0 |