CID 99978
1-(3-mercapto-1-oxopropyl)-l-proline
Structural Information
- Molecular Formula
- C8H13NO3S
- SMILES
- C1C[C@H](N(C1)C(=O)CCS)C(=O)O
- InChI
- InChI=1S/C8H13NO3S/c10-7(3-5-13)9-4-1-2-6(9)8(11)12/h6,13H,1-5H2,(H,11,12)/t6-/m0/s1
- InChIKey
- HYIXVZHJZDSDBA-LURJTMIESA-N
- Compound name
- (2S)-1-(3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 204.06889 | 145.3 |
| [M+Na]+ | 226.05083 | 151.5 |
| [M-H]- | 202.05433 | 146.0 |
| [M+NH4]+ | 221.09543 | 164.5 |
| [M+K]+ | 242.02477 | 150.0 |
| [M+H-H2O]+ | 186.05887 | 139.7 |
| [M+HCOO]- | 248.05981 | 158.9 |
| [M+CH3COO]- | 262.07546 | 179.5 |
| [M+Na-2H]- | 224.03628 | 143.0 |
| [M]+ | 203.06106 | 145.6 |
| [M]- | 203.06216 | 145.6 |